LigandBoxID:D00261

NAME:Cefprozil;Cefprozil monohydrate;CFPZ;Cefzil
SMILES: CC=CC=2CSC3C(C(N3C=2C(=O)O)=O)NC(C(c1ccc(cc1)O)N)=O

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D00261

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C18H19N3O5S 389.431 0 5
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 3 -2.3949 -7.0814
LOGS LOGP    
-3.7989 0.9075    

Links to the same SMILES compounds

LIGANDBOX C06888 D07651
ZINC ZINC03776970 ZINC04474443 ZINC11592640 ZINC11592642 ZINC15449294
ZINC15449296 ZINC20444127 ZINC20444132 ZINC21992407 ZINC33838819 ZINC33838820
ZINC36378487 ZINC36378487 ZINC36378488 ZINC36378488 ZINC36378490 ZINC36378490


[Back to top page]