LigandBoxID:D00333

NAME:Ganciclovir;Cytovene;Vitrasert
SMILES: OCC(OCN1CNC2C(NC(=NC21)N)=O)CO

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D00333

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C9H13N5O4 255.234 0 5
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
6 0 -0.2529 -8.7741
LOGS LOGP    
-2.6977 0.1675    

Links to the same SMILES compounds

LIGANDBOX D04301 PDB_GA2


[Back to top page]