LigandBoxID:D00357

NAME:Losartan potassium;Cozaar
SMILES: CCCCC3NC(C(N3Cc2ccc(c4ccccc4C1NNNN1)cc2)CO)[Cl]

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D00357

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C22H22N6OCl 421.912 -1 1
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 2.0881 -5.5348
LOGS LOGP    
-3.9800 5.3565    

Links to the same SMILES compounds

LIGANDBOX C07072 D08146


[Back to top page]