
SMILES: Nc1ccc(S(Nc2noc(c2)C)(=O)=O)cc1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C10H11N3O3S 253.281 0 3
4 0 -1.3043 -9.4556
-2.7175 1.1787    

Links to the same SMILES compounds

LIGANDBOX C07315 HTS1410-00060611 PDB_08D
ZINC ZINC00089763
PUBCHEM 15899900 165247 169914 17920458 21119281
22667713 23686480 24847784 4164477 432992 44389060
45040440 50919704 51372071 5148655 5329 57350054
6093739 6102242

[Back to top page]