
SMILES: COc1ccc3NC(S(Cc2ncc(c(c2C)OC)C)=O)Nc3c1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C17H19N3O3S 345.422 0 1
5 0 -0.4269 -8.9374
-3.5391 1.4220    

Links to the same SMILES compounds

LIGANDBOX C07324 D01207 D01984 D04056 D05259
D05261 D07917 D09339 D10120 HTS1410-01501313

[Back to top page]