
SMILES: OC3=NC(C(c1ccccc1)(c2ccccc2)N3)=O

2D 3D

SDF file MOL2 file

Compound ID of the source


Calculated physical properties

C15H12N2O2 252.273 0 2
3 0 -0.0227 -9.8516
-3.9354 3.3386    

Links to the same SMILES compounds

LIGANDBOX C07443 D02103

[Back to top page]