LigandBoxID:D00697

NAME:Flumazenil;Romazicon
SMILES: CCOC(C2NCN1C2CN(C(c3cc(ccc31)F)=O)C)=O

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D00697

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C15H14N3O3F 303.293 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
4 0 -1.0439 -9.9550
LOGS LOGP    
-3.6237 2.3424    

Links to the same SMILES compounds

LIGANDBOX C07825


[Back to top page]