
SMILES: CCN1N=C(C(c3cc2ococ2cc31)=O)C(=O)O

2D 3D

SDF file MOL2 file

Compound ID of the source


Calculated physical properties

C12H9N2O5 261.213 -1 0
6 0 2.3072 -4.8516
-1.7020 1.0598    

Links to the same SMILES compounds

LIGANDBOX C08052 HTS1610-00000501
ZINC ZINC00032350
PUBCHEM 2762 46865291 46865292 46865397 6919467

[Back to top page]