
SMILES: CN(CCOc3ccc(C(c2ccccc2)=C(c1ccccc1)CC)cc3)C

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C26H30NO 372.532 1 1
1 0 -4.3506 -10.6376
-6.8047 2.0936    

Links to the same SMILES compounds

LIGANDBOX C07108 D08559 HTS1410-01346108 PDB_CTX PDB_TAX
ZINC ZINC01530689 ZINC01530690
PUBCHEM 10078871 11451630 11512856 11764052 11859056
12543888 154923 16663254 20057167 21150886 21150887
21150888 21150889 23623949 23672 24748532 24875371
25010734 2733525 2733526 3032583 3033630 3036736
3370247 44199365 44472519 44511331 45040456 46917116
5289438 53316424 5376 54582013 5462114 6369059
9809742 9831054 9874333 9896167 9896842 9917806
9917958 9938601 9961084

[Back to top page]