LigandBoxID:D01207

SMILES: COc1ccc3NC(S(Cc2ncc(c(c2C)OC)C)=O)Nc3c1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D01207

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C17H18N3O3S 344.414 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -6.3505 -9.1079
LOGS LOGP    
-0.4557 1.4220    

Links to the same SMILES compounds

LIGANDBOX C07324 D00455 D01984 D04056 D05259
D05261 D07917 D09339 D10120 HTS1306-00119368 HTS1306-01514719


[Back to top page]