
SMILES: Cc1cc2CCCS(c2cc1S(=O)(=O)N)(=O)=O

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C10H13NO4S2 275.347 0 2
4 0 -1.6112 -11.0238
-1.7732 1.1427    

Links to the same SMILES compounds

ZINC ZINC00001718

[Back to top page]