LigandBoxID:D01629

SMILES: CON=C(c1csc(n1)N)C(NC2C(n3c(C(OCOC(C(C)(C)C)=O)=O)c(csc32)C)=O)=O

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D01629

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C20H25N5O7S2 511.578 0 3
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
9 2 -0.6426 -8.7985
LOGS LOGP    
-4.9802 2.5047    

Links to the same SMILES compounds

PUBCHEM 12877767 42066857 44828543 45358086 45358087
53394830 53394831 53750461 5485221 5485222 5486182
5489410 9917387 9958690 9960190


[Back to top page]