LigandBoxID:D01887

SMILES: CCCC(N1CCCN(c2nc(c3cc(c(cc3n2)OC)OC)N)CC1)=O

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D01887

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C19H27N5O3 373.457 0 2
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -0.4050 -8.3877
LOGS LOGP    
-4.8647 2.4358    

Links to the same SMILES compounds

LIGANDBOX D07550
CHEMBL CHEMBL188185
ZINC ZINC00601249
PUBCHEM 115305 11983365 2472 45108257 51375273
54266987


[Back to top page]