LigandBoxID:D01896

NAME:Cilostazol;Pletal
SMILES: C1CCC(N3NNNC3CCCCOc2ccc4NC(CCc4c2)=O)CC1

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D01896

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C20H27N5O2 369.469 0 1
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -0.0015 -9.0136
LOGS LOGP    
-5.8714 4.4654    

[Back to top page]