
SMILES: Nc2ccc(S(NC3CCNN3c1ccccc1)(=O)=O)cc2

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C15H14N4O2S 314.368 0 3
3 0 -1.4463 -8.7897
-3.8669 2.4303    

Links to the same SMILES compounds

LIGANDBOX HTS1410-00102242

[Back to top page]