
NAME:Esomeprazole magnesium hydrate;Esomeprazole magnesium;Nexium
SMILES: COc1ccc3NC(S(Cc2ncc(c(c2C)OC)C)=O)Nc3c1

2D 3D

SDF file MOL2 file

Compound ID of the source


Calculated physical properties

C17H18N3O3S 344.414 0 0
5 0 -6.3544 -9.1062
$$$$ -1.0110    

Links to the same SMILES compounds

LIGANDBOX C07324 D00455 D01207 D04056 D05259
D05261 D07917 D09339 D10120

[Back to top page]