
SMILES: OC(CCC(Nc2ccc(S(Nc1sccn1)(=O)=O)cc2)=O)=O

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C13H12N3O5S2 354.385 -1 2
6 0 -0.2272 -4.7152
-3.5044 0.0256    

Links to the same SMILES compounds

LIGANDBOX C11745 D07060 HTS1410-00773584
ZINC ZINC01532343
PUBCHEM 10389403 24846207 4083112 44154678 5315

[Back to top page]