
SMILES: [Cl]c1ccc(C(=Cc3ccc(cc3[Cl])[Cl])CN2CCNC2)cc1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C18H13N2Cl3 363.675 0 0
1 0 -0.8627 -9.4125
-7.1299 5.6953    

[Back to top page]