LigandBoxID:D02584

SMILES: [Cl]c1ccc(C(=Cc3ccc(cc3[Cl])[Cl])CN2CCNC2)cc1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D02584

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C18H13N2Cl3 363.675 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
1 0 -0.8623 -9.4100
LOGS LOGP    
-7.1299 5.6953    

[Back to top page]