LigandBoxID:D02833

NAME:Alpidem
SMILES: CCCN(C(CC3n2cc(ccc2NC3c1ccc(cc1)[Cl])[Cl])=O)CCC

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D02833

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C21H23N3OCl2 404.341 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
2 0 -0.6892 -8.8477
LOGS LOGP    
-7.4657 4.9615    

[Back to top page]