
SMILES: c1cccc(CN(c3ccccc3)CC2=NCCN2)c1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C17H19N3 265.360 0 1
1 0 0.5588 -8.6151
$$$$ 0.7354    

Links to the same SMILES compounds

LIGANDBOX D07458 D07459 HTS1410-00101053
ZINC ZINC00057204
PUBCHEM 158798 170350 17275 173776 174122
18419 20056963 21124867 2200 222115 24847773
3083406 3084423 44154319 49951956 5257187 57354328

[Back to top page]