LigandBoxID:D03120

NAME:Binodenoson
SMILES: C1CCC(C=NNc2nc(c4NCN(c4n2)C3OC(C(C3O)O)CO)N)CC1

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D03120

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C17H25N7O4 391.432 0 6
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
8 4 -0.0139 -8.5025
LOGS LOGP    
-4.1629 2.6706    

[Back to top page]