LigandBoxID:D03982

SMILES: CN1CCN(c4ccccc4C=c3sccn(c2ccc(c(c2)[Cl])[Cl])c3=O)CC1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D03982

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C22H24N3OSCl2 449.425 1 1
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
1 0 -3.9490 -10.9145
LOGS LOGP    
-5.3992 0.2869    

Links to the same SMILES compounds

LIGANDBOX D03983
PUBCHEM 157047 18551401 57515991 6440589 6440590
6440591 6506050 6506051 6914152


[Back to top page]