
SMILES: CN1CCN(c4ccccc4C=C3SCCN(c2ccc(c(c2)[Cl])[Cl])C3=O)CC1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C22H24N3OSCl2 449.425 1 1
1 0 -3.9030 -10.8823
-5.3992 0.2869    

Links to the same SMILES compounds


[Back to top page]