LigandBoxID:D05017

NAME:Metronidazole phosphate
SMILES: ON(C1CNC(N1CCOP(=O)(O)O)C)=O

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D05017

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C6H8N3O6P 249.119 -2 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
7 0 3.0616 0.3061
LOGS LOGP    
$$$$ 0.3206    

[Back to top page]