
SMILES: COc1ccc3NC(S(Cc2ncc(c(c2C)OC)C)=O)Nc3c1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C17H18N3O3S 344.414 0 0
5 0 -6.3534 -9.1101
$$$$ 1.1832    

Links to the same SMILES compounds

LIGANDBOX C07324 D00455 D01207 D01984 D04056
D05261 D07917 D09339 D10120 HTS1410-01501313

[Back to top page]