LigandBoxID:D05346

NAME:Panadiplon
SMILES: CC(N3C(C5N(c4ccccc43)CNC5c2noc(C1CC1)n2)=O)C

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D05346

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C18H17N5O2 335.367 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -0.7251 -9.2575
LOGS LOGP    
-5.1556 3.8220    

[Back to top page]