LigandBoxID:D05980

NAME:Suritozole
SMILES: Fc1cccc(C2=NN(C(N2C)=S)C)c1

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D05980

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C10H10N3FS 223.274 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
1 0 -0.9434 -8.5112
LOGS LOGP    
-4.9887 3.9241    

Links to the same SMILES compounds

LIGANDBOX HTS1610-00283542
CHEMBL CHEMBL278764
PUBCHEM 25431


[Back to top page]