LigandBoxID:D06300

SMILES: OP(OCC1OC(N3CNc2c(ncnc32)N)C(C1O)O)(=O)O

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D06300

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C10H12N5O7P 345.208 -2 4
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
10 4 3.5407 0.3972
LOGS LOGP    
$$$$ 0.3639    

Links to the same SMILES compounds

LIGANDBOX C00020 C18344 D02769 D06299 HTS1410-00100809
HTS1410-00380663 HTS1410-01551062 HTS1410-02499938 PDB_A PDB_A5O PDB_AMP
PDB_AP7


[Back to top page]