LigandBoxID:D07089

NAME:Moxaverine
SMILES: CCc2nc(c3cc(c(cc3c2)OC)OC)Cc1ccccc1

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D07089

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C20H21NO2 307.393 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
3 0 -0.6501 -8.8733
LOGS LOGP    
-4.8440 4.2152    

Links to the same SMILES compounds

LIGANDBOX D08238 HTS1610-00237576
ZINC ZINC00001754
PUBCHEM 21441076 57516076 70881 70882


[Back to top page]