LigandBoxID:D07629

SMILES: N#CCC(NC1C(n2c1scc(c2C(=O)O)COC(=O)C)=O)=O

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D07629

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C13H12N3O6S 338.319 -1 1
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
7 2 2.4027 -5.1897
LOGS LOGP    
-1.7320 -0.4922    

Links to the same SMILES compounds

LIGANDBOX C12691 D01262
PUBCHEM 13035349 23662389 23668837 23692861 31726
44146850 54282755 91562


[Back to top page]