LigandBoxID:D07659

SMILES: CON=C(c1csc(n1)N)C(NC3C(N4C(=C(CSC43)CSc2nc(c(nn2C)=O)=O)C(=O)O)=O)=O

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D07659

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C18H17N8O7S3 553.578 -1 4
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
10 2 1.0800 -5.1192
LOGS LOGP    
-4.8892 0.2611    

Links to the same SMILES compounds

LIGANDBOX C06683 D00924 HTS1410-01548460 HTS1410-02009023 HTS1410-04556512


[Back to top page]