
SMILES: COCCOc2cc3ncnc(c3cc2OCCOC)Nc1ccc(cc1)C#C

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C22H23N3O4 393.443 0 1
6 0 -0.9653 -8.8197
-4.8004 3.0759    

Links to the same SMILES compounds

ZINC ZINC11617006
PUBCHEM 11954378 11954379

[Back to top page]