LigandBoxID:D08507

NAME:Sarmazenil;Sarmazol [veterinary]
SMILES: CCOC(C1NCN2c3cccc(c3C(N(CC21)C)=O)[Cl])=O

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D08507

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C15H14N3O3Cl 319.748 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
4 0 -0.9156 -9.8897
LOGS LOGP    
-4.1099 2.4769    

[Back to top page]