LigandBoxID:D08619

SMILES: CC(NC(NS(c2cnccc2Nc1cccc(c1)C)(=O)=O)=O)C

2D 3D

SDF file MOL2 file

Suppliers' compound IDs

KEGG_DRUG
D08619

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C16H20N4O3S 348.426 0 3
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
4 0 -1.7142 -8.9781
LOGS LOGP    
-0.6539 1.1412    

Links to the same SMILES compounds

LIGANDBOX D00382
CHEMBL CHEMBL1148
PUBCHEM 11349644 18993395 20025616 41781 46174116
46783113 9801583 9930540 9931295 9998308


[Back to top page]