
SMILES: CC(NC(NS(c2cnccc2Nc1cccc(c1)C)(=O)=O)=O)C

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C16H20N4O3S 348.426 0 3
4 0 -1.7196 -8.9792
-0.6539 1.1412    

Links to the same SMILES compounds

PUBCHEM 11349644 18993395 20025616 41781 46174116
46783113 9801583 9930540 9931295 9998308

[Back to top page]