
SMILES: n1ccc(CNc3ncccc3C(Nc2ccc4C(CNc4c2)(C)C)=O)cc1

2D 3D

SDF file MOL2 file

Suppliers' compound IDs


Calculated physical properties

C22H23N5O 373.460 0 3
3 0 -0.3521 -8.3687
$$$$ -3.0713    

Links to the same SMILES compounds

ZINC ZINC18710082
PUBCHEM 11667893 16097729 16720764 23729449

[Back to top page]