LigandBoxID:D09602

NAME:Dilmapimod
SMILES: OCC(Nc1nc(c2ccc(cc2C)F)c4C=CC(N(c3c(cccc3F)F)c4n1)=O)CO

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D09602

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C23H19N4O3F3 456.424 0 3
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -1.0497 -9.2540
LOGS LOGP    
-6.9941 3.9793    

Links to the same SMILES compounds

LIGANDBOX D09603


[Back to top page]