
SMILES: c1ccc(c2ccc4ccc(C6NC(C3CC(C3)(O)C)n5ccnc(c65)N)cc4n2)cc1

2D 3D

SDF file MOL2 file

Compound ID of the source


Calculated physical properties

C26H23N5O 421.504 0 3
4 0 -0.8949 -8.3127
-6.9540 4.7546    

[Back to top page]