
NAME:Dabrafenib mesylate
SMILES: CC(c2sc(c(c4cccc(c4F)NS(c3c(cccc3F)F)(=O)=O)n2)c1ccnc(n1)N)(C)C

2D 3D

SDF file MOL2 file

Compound ID of the source


Calculated physical properties

C23H20N5O2F3S2 519.570 0 3
5 0 -1.6909 -9.0478
$$$$ 1.3760    

Links to the same SMILES compounds

PUBCHEM 44462760 44516822 56934551

[Back to top page]