
SMILES: OC(c2cccc(c4nc(NC(C1(c3ccc5oc(oc5c3)(F)F)CC1)=O)ccc4C)c2)=O

2D 3D

SDF file MOL2 file

Compound ID of the source


Calculated physical properties

C24H17N2O5F2 451.405 -1 1
6 0 1.0860 -4.8435
-6.6988 4.5148    

Links to the same SMILES compounds

ZINC ZINC64033452
PUBCHEM 16678941 45480518 51347960

[Back to top page]