LigandBoxID:D10194

NAME:Remimazolam besilate
SMILES: COC(CCC2N=C(c4cc(ccc4N3C(CNC32)C)[Br])c1ccccn1)=O

2D 3D

SDF file MOL2 file

Compound ID of the source

KEGG_DRUG
D10194

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C21H19N4O2Br 439.313 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 1 -0.9521 -9.3743
LOGS LOGP    
$$$$ 3.5393    

[Back to top page]